C24H18O4 — CID 139645771
dimethyl 1-naphthalen-1-ylnaphthalene-2,3-dicarboxylate (PubChem CID 139645771) has the molecular formula C24H18O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is dimethyl 1-naphthalen-1-ylnaphthalene-2,3-dicarboxylate.
| Compound Name | dimethyl 1-naphthalen-1-ylnaphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 139645771 |
| Molecular Formula | C24H18O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | dimethyl 1-naphthalen-1-ylnaphthalene-2,3-dicarboxylate |
| SMILES | COC(=O)c1cc2ccccc2c(-c2cccc3ccccc23)c1C(=O)OC |
| InChI | InChI=1S/C24H18O4/c1-27-23(25)20-14-16-9-4-6-12-18(16)21(22(20)24(26)28-2)19-13-7-10-15-8-3-5-11-17(15)19/h3-14H,1-2H3 |
| InChIKey | PTHDDRYPOUTYAM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |