C26H24O8 — CID 71682574
dimethyl 5-(2-methoxy-2-oxoethyl)-1-[2-(2-methoxy-2-oxoethyl)phenyl]naphthalene-2,3-dicarboxylate (PubChem CID 71682574) has the molecular formula C26H24O8 and a molecular weight of 464.47 g/mol. Its IUPAC name is dimethyl 5-(2-methoxy-2-oxoethyl)-1-[2-(2-methoxy-2-oxoethyl)phenyl]naphthalene-2,3-dicarboxylate.
| Compound Name | dimethyl 5-(2-methoxy-2-oxoethyl)-1-[2-(2-methoxy-2-oxoethyl)phenyl]naphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 71682574 |
| Molecular Formula | C26H24O8 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | dimethyl 5-(2-methoxy-2-oxoethyl)-1-[2-(2-methoxy-2-oxoethyl)phenyl]naphthalene-2,3-dicarboxylate |
| SMILES | COC(=O)Cc1ccccc1-c1c(C(=O)OC)c(C(=O)OC)cc2c(CC(=O)OC)cccc12 |
| InChI | InChI=1S/C26H24O8/c1-31-21(27)12-15-8-5-6-10-17(15)23-18-11-7-9-16(13-22(28)32-2)19(18)14-20(25(29)33-3)24(23)26(30)34-4/h5-11,14H,12-13H2,1-4H3 |
| InChIKey | PEXAPNRVXKIVIE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|