ethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate

C20H19BrO2 — CID 144844652

IUPACethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate
SMILESCC.COC(=O)c1cc(Br)ccc1-c1cccc2ccccc12
InChIInChI=1S/C18H13BrO2.C2H6/c1-21-18(20)17-11-13(19)9-10-16(17)15-8-4-6-12-5-2-3-7-14(12)15;1-2/h2-11H,1H3;1-2H3
InChIKeySURPLAIHNGOSMF-UHFFFAOYSA-N
MW371.27 g/mol
LogP6.08
Rot. Bonds2

About ethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate

ethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate (PubChem CID 144844652) has the molecular formula C20H19BrO2 and a molecular weight of 371.27 g/mol. Its IUPAC name is ethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate.

Molecular Properties

Compound Nameethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate
PubChem CID144844652
Molecular FormulaC20H19BrO2
Molecular Weight371.27 g/mol
Exact Mass370.06
IUPAC Nameethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate
SMILESCC.COC(=O)c1cc(Br)ccc1-c1cccc2ccccc12
InChIInChI=1S/C18H13BrO2.C2H6/c1-21-18(20)17-11-13(19)9-10-16(17)15-8-4-6-12-5-2-3-7-14(12)15;1-2/h2-11H,1H3;1-2H3
InChIKeySURPLAIHNGOSMF-UHFFFAOYSA-N
XLogP6.08
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500371.27
LogP ≤ 56.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze ethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate?
The IUPAC name of ethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate (CID 144844652) is ethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate.
What is the SMILES notation for ethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate?
The canonical SMILES for ethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate is CC.COC(=O)c1cc(Br)ccc1-c1cccc2ccccc12.
What is the InChIKey of ethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate?
The InChIKey is SURPLAIHNGOSMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrO2.C2H6/c1-21-18(20)17-11-13(19)9-10-16(17)15-8-4-6-12-5-2-3-7-14(12)15;1-2/h2-11H,1H3;1-2H3.
What are the key properties of ethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate?
ethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate has a molecular weight of 371.27 g/mol, XLogP of 6.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 5-bromo-2-naphthalen-1-ylbenzoate is sourced from PubChem (CID 144844652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).