methyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate

C22H15BrN2O2 — CID 132502729

IUPACmethyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate
SMILESCOC(=O)c1cc(Br)ccc1-c1nc2ccccc2nc1-c1ccccc1
InChIInChI=1S/C22H15BrN2O2/c1-27-22(26)17-13-15(23)11-12-16(17)21-20(14-7-3-2-4-8-14)24-18-9-5-6-10-19(18)25-21/h2-13H,1H3
InChIKeyFOKKWXCBCNBZCD-UHFFFAOYSA-N
MW419.28 g/mol
LogP5.51
Rot. Bonds3

About methyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate

methyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate (PubChem CID 132502729) has the molecular formula C22H15BrN2O2 and a molecular weight of 419.28 g/mol. Its IUPAC name is methyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate.

Molecular Properties

Compound Namemethyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate
PubChem CID132502729
Molecular FormulaC22H15BrN2O2
Molecular Weight419.28 g/mol
Exact Mass418.03
IUPAC Namemethyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate
SMILESCOC(=O)c1cc(Br)ccc1-c1nc2ccccc2nc1-c1ccccc1
InChIInChI=1S/C22H15BrN2O2/c1-27-22(26)17-13-15(23)11-12-16(17)21-20(14-7-3-2-4-8-14)24-18-9-5-6-10-19(18)25-21/h2-13H,1H3
InChIKeyFOKKWXCBCNBZCD-UHFFFAOYSA-N
XLogP5.51
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms27
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500419.28
LogP ≤ 55.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate?
The IUPAC name of methyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate (CID 132502729) is methyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate.
What is the SMILES notation for methyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate?
The canonical SMILES for methyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate is COC(=O)c1cc(Br)ccc1-c1nc2ccccc2nc1-c1ccccc1.
What is the InChIKey of methyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate?
The InChIKey is FOKKWXCBCNBZCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15BrN2O2/c1-27-22(26)17-13-15(23)11-12-16(17)21-20(14-7-3-2-4-8-14)24-18-9-5-6-10-19(18)25-21/h2-13H,1H3.
What are the key properties of methyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate?
methyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate has a molecular weight of 419.28 g/mol, XLogP of 5.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-bromo-2-(3-phenylquinoxalin-2-yl)benzoate is sourced from PubChem (CID 132502729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).