C16H12NO2S+ — CID 21240753
methyl 3-phenyl-1,4-benzothiazin-1-ium-2-carboxylate (PubChem CID 21240753) has the molecular formula C16H12NO2S+ and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl 3-phenyl-1,4-benzothiazin-1-ium-2-carboxylate.
| Compound Name | methyl 3-phenyl-1,4-benzothiazin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 21240753 |
| Molecular Formula | C16H12NO2S+ |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | methyl 3-phenyl-1,4-benzothiazin-1-ium-2-carboxylate |
| SMILES | COC(=O)c1[s+]c2ccccc2nc1-c1ccccc1 |
| InChI | InChI=1S/C16H12NO2S/c1-19-16(18)15-14(11-7-3-2-4-8-11)17-12-9-5-6-10-13(12)20-15/h2-10H,1H3/q+1 |
| InChIKey | WJGBEOYLIBVINX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|