C20H12Br2N2 — CID 101356816
2-(2,5-dibromophenyl)-3-phenylquinoxaline (PubChem CID 101356816) has the molecular formula C20H12Br2N2 and a molecular weight of 440.14 g/mol. Its IUPAC name is 2-(2,5-dibromophenyl)-3-phenylquinoxaline.
| Compound Name | 2-(2,5-dibromophenyl)-3-phenylquinoxaline |
|---|---|
| PubChem CID | 101356816 |
| Molecular Formula | C20H12Br2N2 |
| Molecular Weight | 440.14 g/mol |
| Exact Mass | 437.94 |
| IUPAC Name | 2-(2,5-dibromophenyl)-3-phenylquinoxaline |
| SMILES | Brc1ccc(Br)c(-c2nc3ccccc3nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C20H12Br2N2/c21-14-10-11-16(22)15(12-14)20-19(13-6-2-1-3-7-13)23-17-8-4-5-9-18(17)24-20/h1-12H |
| InChIKey | AACVLALKISJSJF-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.14 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |