C35H34N2 — CID 170567818
2-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)-3-phenylquinoxaline (PubChem CID 170567818) has the molecular formula C35H34N2 and a molecular weight of 482.67 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)-3-phenylquinoxaline.
| Compound Name | 2-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)-3-phenylquinoxaline |
|---|---|
| PubChem CID | 170567818 |
| Molecular Formula | C35H34N2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 2-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)-3-phenylquinoxaline |
| SMILES | CC1(C)c2cc(-c3ccccc3)c(-c3nc4ccccc4nc3-c3ccccc3)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C35H34N2/c1-33(2)27-21-25(23-15-9-7-10-16-23)26(22-28(27)34(3,4)35(33,5)6)32-31(24-17-11-8-12-18-24)36-29-19-13-14-20-30(29)37-32/h7-22H,1-6H3 |
| InChIKey | WJBCIMPGSFOHRS-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |