C14H12O5 — CID 2752722
dimethyl 1-hydroxynaphthalene-2,3-dicarboxylate (PubChem CID 2752722) has the molecular formula C14H12O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is dimethyl 1-hydroxynaphthalene-2,3-dicarboxylate.
| Compound Name | dimethyl 1-hydroxynaphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 2752722 |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | dimethyl 1-hydroxynaphthalene-2,3-dicarboxylate |
| SMILES | COC(=O)c1cc2ccccc2c(O)c1C(=O)OC |
| InChI | InChI=1S/C14H12O5/c1-18-13(16)10-7-8-5-3-4-6-9(8)12(15)11(10)14(17)19-2/h3-7,15H,1-2H3 |
| InChIKey | UCYAHIVNBSURER-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |