C22H26O5 — CID 177385894
dimethyl 1-[(Z)-2-methoxyhept-2-en-3-yl]naphthalene-2,3-dicarboxylate (PubChem CID 177385894) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is dimethyl 1-[(Z)-2-methoxyhept-2-en-3-yl]naphthalene-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[(Z)-2-methoxyhept-2-en-3-yl]naphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 177385894 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | dimethyl 1-[(Z)-2-methoxyhept-2-en-3-yl]naphthalene-2,3-dicarboxylate |
| SMILES | CCCC/C(=C(\C)OC)c1c(C(=O)OC)c(C(=O)OC)cc2ccccc12 |
| InChI | InChI=1S/C22H26O5/c1-6-7-11-16(14(2)25-3)19-17-12-9-8-10-15(17)13-18(21(23)26-4)20(19)22(24)27-5/h8-10,12-13H,6-7,11H2,1-5H3/b16-14- |
| InChIKey | SYJALUPUHXPOFS-PEZBUJJGSA-N |
| XLogP | 4.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|