About methyl 2-benzoylbenzoate
methyl 2-benzoylbenzoate (PubChem CID 11816) has the molecular formula C15H12O3
and a molecular weight of 240.26 g/mol. Its IUPAC name is methyl 2-benzoylbenzoate.
Molecular Properties
| Compound Name | methyl 2-benzoylbenzoate |
| PubChem CID | 11816 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | methyl 2-benzoylbenzoate |
| SMILES | COC(=O)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H12O3/c1-18-15(17)13-10-6-5-9-12(13)14(16)11-7-3-2-4-8-11/h2-10H,1H3 |
| InChIKey | NQSMEZJWJJVYOI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-benzoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-benzoylbenzoate?
The IUPAC name of methyl 2-benzoylbenzoate (CID 11816) is methyl 2-benzoylbenzoate.
What is the SMILES notation for methyl 2-benzoylbenzoate?
The canonical SMILES for methyl 2-benzoylbenzoate is COC(=O)c1ccccc1C(=O)c1ccccc1.
What is the InChIKey of methyl 2-benzoylbenzoate?
The InChIKey is NQSMEZJWJJVYOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O3/c1-18-15(17)13-10-6-5-9-12(13)14(16)11-7-3-2-4-8-11/h2-10H,1H3.
What are the key properties of methyl 2-benzoylbenzoate?
methyl 2-benzoylbenzoate has a molecular weight of 240.26 g/mol, XLogP of 2.70, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-benzoylbenzoate is sourced from PubChem (CID 11816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).