C20H17FO3 — CID 24786853
methyl 5-fluoro-2-hydroxy-3,4-dimethyl-6-naphthalen-1-ylbenzoate (PubChem CID 24786853) has the molecular formula C20H17FO3 and a molecular weight of 324.35 g/mol. Its IUPAC name is methyl 5-fluoro-2-hydroxy-3,4-dimethyl-6-naphthalen-1-ylbenzoate.
| Compound Name | methyl 5-fluoro-2-hydroxy-3,4-dimethyl-6-naphthalen-1-ylbenzoate |
|---|---|
| PubChem CID | 24786853 |
| Molecular Formula | C20H17FO3 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | methyl 5-fluoro-2-hydroxy-3,4-dimethyl-6-naphthalen-1-ylbenzoate |
| SMILES | COC(=O)c1c(O)c(C)c(C)c(F)c1-c1cccc2ccccc12 |
| InChI | InChI=1S/C20H17FO3/c1-11-12(2)19(22)17(20(23)24-3)16(18(11)21)15-10-6-8-13-7-4-5-9-14(13)15/h4-10,22H,1-3H3 |
| InChIKey | ITQDHSXDLLKBRB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |