C15H11NO2S — CID 113306366
methyl 2-naphthalen-1-yl-1,3-thiazole-4-carboxylate (PubChem CID 113306366) has the molecular formula C15H11NO2S and a molecular weight of 269.33 g/mol. Its IUPAC name is methyl 2-naphthalen-1-yl-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-naphthalen-1-yl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 113306366 |
| Molecular Formula | C15H11NO2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | methyl 2-naphthalen-1-yl-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(-c2cccc3ccccc23)n1 |
| InChI | InChI=1S/C15H11NO2S/c1-18-15(17)13-9-19-14(16-13)12-8-4-6-10-5-2-3-7-11(10)12/h2-9H,1H3 |
| InChIKey | IDHNJWDAFZGPBL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |