C12H10INO2S — CID 169498575
methyl 2-(2-iodo-3-methylphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 169498575) has the molecular formula C12H10INO2S and a molecular weight of 359.19 g/mol. Its IUPAC name is methyl 2-(2-iodo-3-methylphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(2-iodo-3-methylphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 169498575 |
| Molecular Formula | C12H10INO2S |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | methyl 2-(2-iodo-3-methylphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(-c2cccc(C)c2I)n1 |
| InChI | InChI=1S/C12H10INO2S/c1-7-4-3-5-8(10(7)13)11-14-9(6-17-11)12(15)16-2/h3-6H,1-2H3 |
| InChIKey | GPFRQFYAXXYBAT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|