C13H13NO2S — CID 115422199
methyl 2-(2-ethylphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 115422199) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is methyl 2-(2-ethylphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(2-ethylphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 115422199 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | methyl 2-(2-ethylphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCc1ccccc1-c1nc(C(=O)OC)cs1 |
| InChI | InChI=1S/C13H13NO2S/c1-3-9-6-4-5-7-10(9)12-14-11(8-17-12)13(15)16-2/h4-8H,3H2,1-2H3 |
| InChIKey | AWWPEVHLVNFJSO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |