C10H7BrN2O2S — CID 169498453
methyl 2-(6-bromo-3-pyridinyl)-1,3-thiazole-4-carboxylate (PubChem CID 169498453) has the molecular formula C10H7BrN2O2S and a molecular weight of 299.15 g/mol. Its IUPAC name is methyl 2-(6-bromo-3-pyridinyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(6-bromo-3-pyridinyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 169498453 |
| Molecular Formula | C10H7BrN2O2S |
| Molecular Weight | 299.15 g/mol |
| Exact Mass | 297.94 |
| IUPAC Name | methyl 2-(6-bromo-3-pyridinyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(-c2ccc(Br)nc2)n1 |
| InChI | InChI=1S/C10H7BrN2O2S/c1-15-10(14)7-5-16-9(13-7)6-2-3-8(11)12-4-6/h2-5H,1H3 |
| InChIKey | RHIBNJZOIZVFRL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.15 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|