C11H7BrClNO2S — CID 103372618
methyl 2-(4-bromo-3-chlorophenyl)-1,3-thiazole-4-carboxylate (PubChem CID 103372618) has the molecular formula C11H7BrClNO2S and a molecular weight of 332.61 g/mol. Its IUPAC name is methyl 2-(4-bromo-3-chlorophenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(4-bromo-3-chlorophenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 103372618 |
| Molecular Formula | C11H7BrClNO2S |
| Molecular Weight | 332.61 g/mol |
| Exact Mass | 330.91 |
| IUPAC Name | methyl 2-(4-bromo-3-chlorophenyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(-c2ccc(Br)c(Cl)c2)n1 |
| InChI | InChI=1S/C11H7BrClNO2S/c1-16-11(15)9-5-17-10(14-9)6-2-3-7(12)8(13)4-6/h2-5H,1H3 |
| InChIKey | CCESPTVCLNGRIW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |