C17H10BrCl2NO2S — CID 141449706
methyl 2-bromo-5-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoate (PubChem CID 141449706) has the molecular formula C17H10BrCl2NO2S and a molecular weight of 443.15 g/mol. Its IUPAC name is methyl 2-bromo-5-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoate.
| Compound Name | methyl 2-bromo-5-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 141449706 |
| Molecular Formula | C17H10BrCl2NO2S |
| Molecular Weight | 443.15 g/mol |
| Exact Mass | 440.90 |
| IUPAC Name | methyl 2-bromo-5-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoate |
| SMILES | COC(=O)c1cc(-c2nc(-c3ccc(Cl)cc3Cl)cs2)ccc1Br |
| InChI | InChI=1S/C17H10BrCl2NO2S/c1-23-17(22)12-6-9(2-5-13(12)18)16-21-15(8-24-16)11-4-3-10(19)7-14(11)20/h2-8H,1H3 |
| InChIKey | QPGRXYVMCAHACW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.15 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |