C16H9Cl2NO2S — CID 1483674
4-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoic acid (PubChem CID 1483674) has the molecular formula C16H9Cl2NO2S and a molecular weight of 350.23 g/mol. Its IUPAC name is 4-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoic acid.
| Compound Name | 4-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 1483674 |
| Molecular Formula | C16H9Cl2NO2S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 4-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nc(-c3ccc(Cl)cc3Cl)cs2)cc1 |
| InChI | InChI=1S/C16H9Cl2NO2S/c17-11-5-6-12(13(18)7-11)14-8-22-15(19-14)9-1-3-10(4-2-9)16(20)21/h1-8H,(H,20,21) |
| InChIKey | PHLNMNRVMBDTSX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |