C16H10Cl2N2O2S — CID 143557037
amino 3-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoate (PubChem CID 143557037) has the molecular formula C16H10Cl2N2O2S and a molecular weight of 365.24 g/mol. Its IUPAC name is amino 3-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoate.
| Compound Name | amino 3-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 143557037 |
| Molecular Formula | C16H10Cl2N2O2S |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | amino 3-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoate |
| SMILES | NOC(=O)c1cccc(-c2nc(-c3ccc(Cl)cc3Cl)cs2)c1 |
| InChI | InChI=1S/C16H10Cl2N2O2S/c17-11-4-5-12(13(18)7-11)14-8-23-15(20-14)9-2-1-3-10(6-9)16(21)22-19/h1-8H,19H2 |
| InChIKey | WVMWCUXFHMWFNM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|