C19H15ClFN3OS — CID 145149558
5-[4-(4-amino-2-chlorophenyl)-1,3-thiazol-2-yl]-N-cyclopropyl-2-fluorobenzamide (PubChem CID 145149558) has the molecular formula C19H15ClFN3OS and a molecular weight of 387.87 g/mol. Its IUPAC name is 5-[4-(4-amino-2-chlorophenyl)-1,3-thiazol-2-yl]-N-cyclopropyl-2-fluorobenzamide.
| Compound Name | 5-[4-(4-amino-2-chlorophenyl)-1,3-thiazol-2-yl]-N-cyclopropyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 145149558 |
| Molecular Formula | C19H15ClFN3OS |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 5-[4-(4-amino-2-chlorophenyl)-1,3-thiazol-2-yl]-N-cyclopropyl-2-fluorobenzamide |
| SMILES | Nc1ccc(-c2csc(-c3ccc(F)c(C(=O)NC4CC4)c3)n2)c(Cl)c1 |
| InChI | InChI=1S/C19H15ClFN3OS/c20-15-8-11(22)2-5-13(15)17-9-26-19(24-17)10-1-6-16(21)14(7-10)18(25)23-12-3-4-12/h1-2,5-9,12H,3-4,22H2,(H,23,25) |
| InChIKey | AQDICNMPQIGMQA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|