C13H11ClN2OS — CID 26736860
2-(4-chlorophenyl)-N-cyclopropyl-1,3-thiazole-4-carboxamide (PubChem CID 26736860) has the molecular formula C13H11ClN2OS and a molecular weight of 278.76 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-cyclopropyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-cyclopropyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 26736860 |
| Molecular Formula | C13H11ClN2OS |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 2-(4-chlorophenyl)-N-cyclopropyl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CC1)c1csc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C13H11ClN2OS/c14-9-3-1-8(2-4-9)13-16-11(7-18-13)12(17)15-10-5-6-10/h1-4,7,10H,5-6H2,(H,15,17) |
| InChIKey | QJXFEKOCBDACGR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |