C22H20ClN3O2S — CID 34424164
N-[1-[2-(4-chlorophenyl)-1,3-thiazole-4-carbonyl]piperidin-4-yl]benzamide (PubChem CID 34424164) has the molecular formula C22H20ClN3O2S and a molecular weight of 425.94 g/mol. Its IUPAC name is N-[1-[2-(4-chlorophenyl)-1,3-thiazole-4-carbonyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[2-(4-chlorophenyl)-1,3-thiazole-4-carbonyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 34424164 |
| Molecular Formula | C22H20ClN3O2S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-[1-[2-(4-chlorophenyl)-1,3-thiazole-4-carbonyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)c2csc(-c3ccc(Cl)cc3)n2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H20ClN3O2S/c23-17-8-6-16(7-9-17)21-25-19(14-29-21)22(28)26-12-10-18(11-13-26)24-20(27)15-4-2-1-3-5-15/h1-9,14,18H,10-13H2,(H,24,27) |
| InChIKey | VGCHJHOGQYCFHH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |