C16H16ClN3O2S — CID 51943430
2-(4-chlorophenyl)-N-[(3S)-2-oxoazepan-3-yl]-1,3-thiazole-4-carboxamide (PubChem CID 51943430) has the molecular formula C16H16ClN3O2S and a molecular weight of 349.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(3S)-2-oxoazepan-3-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(3S)-2-oxoazepan-3-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 51943430 |
| Molecular Formula | C16H16ClN3O2S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(3S)-2-oxoazepan-3-yl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(N[C@H]1CCCCNC1=O)c1csc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H16ClN3O2S/c17-11-6-4-10(5-7-11)16-20-13(9-23-16)15(22)19-12-3-1-2-8-18-14(12)21/h4-7,9,12H,1-3,8H2,(H,18,21)(H,19,22)/t12-/m0/s1 |
| InChIKey | YXVMPVHAPDSDMM-LBPRGKRZSA-N |
| XLogP | 2.86 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |