C22H20ClFN4O2 — CID 5041512
1-(4-chlorophenyl)-3-(4-fluorophenyl)-N-(2-oxoazepan-3-yl)pyrazole-5-carboxamide (PubChem CID 5041512) has the molecular formula C22H20ClFN4O2 and a molecular weight of 426.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(4-fluorophenyl)-N-(2-oxoazepan-3-yl)pyrazole-5-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-3-(4-fluorophenyl)-N-(2-oxoazepan-3-yl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 5041512 |
| Molecular Formula | C22H20ClFN4O2 |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(4-fluorophenyl)-N-(2-oxoazepan-3-yl)pyrazole-5-carboxamide |
| SMILES | O=C(NC1CCCCNC1=O)c1cc(-c2ccc(F)cc2)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClFN4O2/c23-15-6-10-17(11-7-15)28-20(13-19(27-28)14-4-8-16(24)9-5-14)22(30)26-18-3-1-2-12-25-21(18)29/h4-11,13,18H,1-3,12H2,(H,25,29)(H,26,30) |
| InChIKey | CRUSVVVENUSEHG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |