About 2-(3,4-difluorophenyl)-N-(2-hydroxycyclohexyl)-1,3-thiazole-4-carboxamide
2-(3,4-difluorophenyl)-N-(2-hydroxycyclohexyl)-1,3-thiazole-4-carboxamide (PubChem CID 110021576) has the molecular formula C16H16F2N2O2S
and a molecular weight of 338.38 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-N-(2-hydroxycyclohexyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(3,4-difluorophenyl)-N-(2-hydroxycyclohexyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 110021576 |
| Molecular Formula | C16H16F2N2O2S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-(3,4-difluorophenyl)-N-(2-hydroxycyclohexyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CCCCC1O)c1csc(-c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C16H16F2N2O2S/c17-10-6-5-9(7-11(10)18)16-20-13(8-23-16)15(22)19-12-3-1-2-4-14(12)21/h5-8,12,14,21H,1-4H2,(H,19,22) |
| InChIKey | MCZSKUGGNVKXHQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-difluorophenyl)-N-(2-hydroxycyclohexyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-difluorophenyl)-N-(2-hydroxycyclohexyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(3,4-difluorophenyl)-N-(2-hydroxycyclohexyl)-1,3-thiazole-4-carboxamide (CID 110021576) is 2-(3,4-difluorophenyl)-N-(2-hydroxycyclohexyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(3,4-difluorophenyl)-N-(2-hydroxycyclohexyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(3,4-difluorophenyl)-N-(2-hydroxycyclohexyl)-1,3-thiazole-4-carboxamide is O=C(NC1CCCCC1O)c1csc(-c2ccc(F)c(F)c2)n1.
What is the InChIKey of 2-(3,4-difluorophenyl)-N-(2-hydroxycyclohexyl)-1,3-thiazole-4-carboxamide?
The InChIKey is MCZSKUGGNVKXHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F2N2O2S/c17-10-6-5-9(7-11(10)18)16-20-13(8-23-16)15(22)19-12-3-1-2-4-14(12)21/h5-8,12,14,21H,1-4H2,(H,19,22).
What are the key properties of 2-(3,4-difluorophenyl)-N-(2-hydroxycyclohexyl)-1,3-thiazole-4-carboxamide?
2-(3,4-difluorophenyl)-N-(2-hydroxycyclohexyl)-1,3-thiazole-4-carboxamide has a molecular weight of 338.38 g/mol, XLogP of 3.12, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-difluorophenyl)-N-(2-hydroxycyclohexyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 110021576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).