C23H21Cl2N3O2 — CID 11385186
5,6-bis(4-chlorophenyl)-N-[(1R,2R)-2-hydroxycyclohexyl]pyrazine-2-carboxamide (PubChem CID 11385186) has the molecular formula C23H21Cl2N3O2 and a molecular weight of 442.35 g/mol. Its IUPAC name is 5,6-bis(4-chlorophenyl)-N-[(1R,2R)-2-hydroxycyclohexyl]pyrazine-2-carboxamide.
| Compound Name | 5,6-bis(4-chlorophenyl)-N-[(1R,2R)-2-hydroxycyclohexyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11385186 |
| Molecular Formula | C23H21Cl2N3O2 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 5,6-bis(4-chlorophenyl)-N-[(1R,2R)-2-hydroxycyclohexyl]pyrazine-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1cnc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C23H21Cl2N3O2/c24-16-9-5-14(6-10-16)21-22(15-7-11-17(25)12-8-15)27-19(13-26-21)23(30)28-18-3-1-2-4-20(18)29/h5-13,18,20,29H,1-4H2,(H,28,30)/t18-,20-/m1/s1 |
| InChIKey | YSGRWDRMHSNFDZ-UYAOXDASSA-N |
| XLogP | 5.15 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |