C23H23N3O — CID 10150172
N-cyclohexyl-5,6-diphenylpyrazine-2-carboxamide (PubChem CID 10150172) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is N-cyclohexyl-5,6-diphenylpyrazine-2-carboxamide.
| Compound Name | N-cyclohexyl-5,6-diphenylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 10150172 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-cyclohexyl-5,6-diphenylpyrazine-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H23N3O/c27-23(25-19-14-8-3-9-15-19)20-16-24-21(17-10-4-1-5-11-17)22(26-20)18-12-6-2-7-13-18/h1-2,4-7,10-13,16,19H,3,8-9,14-15H2,(H,25,27) |
| InChIKey | VWNCSOQRHOYLDZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |