C12H15ClN2O2 — CID 104927278
5-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]pyridine-2-carboxamide (PubChem CID 104927278) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 5-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]pyridine-2-carboxamide.
| Compound Name | 5-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104927278 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 5-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]pyridine-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C12H15ClN2O2/c13-8-5-6-10(14-7-8)12(17)15-9-3-1-2-4-11(9)16/h5-7,9,11,16H,1-4H2,(H,15,17)/t9-,11-/m1/s1 |
| InChIKey | ISMQCRTUVQGVPX-MWLCHTKSSA-N |
| XLogP | 1.77 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |