C9H14N4O2 — CID 104927988
N-[(1R,2R)-2-hydroxycyclohexyl]-2H-triazole-4-carboxamide (PubChem CID 104927988) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 104927988 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]-2H-triazole-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1cn[nH]n1 |
| InChI | InChI=1S/C9H14N4O2/c14-8-4-2-1-3-6(8)11-9(15)7-5-10-13-12-7/h5-6,8,14H,1-4H2,(H,11,15)(H,10,12,13)/t6-,8-/m1/s1 |
| InChIKey | SRUHHIKXBHNLLN-HTRCEHHLSA-N |
| XLogP | -0.16 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |