C7H9ClN4O2 — CID 127002033
N-(4-chlorooxolan-3-yl)-2H-triazole-4-carboxamide (PubChem CID 127002033) has the molecular formula C7H9ClN4O2 and a molecular weight of 216.63 g/mol. Its IUPAC name is N-(4-chlorooxolan-3-yl)-2H-triazole-4-carboxamide.
| Compound Name | N-(4-chlorooxolan-3-yl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 127002033 |
| Molecular Formula | C7H9ClN4O2 |
| Molecular Weight | 216.63 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | N-(4-chlorooxolan-3-yl)-2H-triazole-4-carboxamide |
| SMILES | O=C(NC1COCC1Cl)c1cn[nH]n1 |
| InChI | InChI=1S/C7H9ClN4O2/c8-4-2-14-3-6(4)10-7(13)5-1-9-12-11-5/h1,4,6H,2-3H2,(H,10,13)(H,9,11,12) |
| InChIKey | HLSNAUNLJQNQQM-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.63 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|