C8H11N5O2 — CID 78918284
N-(6-oxopiperidin-3-yl)-2H-triazole-4-carboxamide (PubChem CID 78918284) has the molecular formula C8H11N5O2 and a molecular weight of 209.21 g/mol. Its IUPAC name is N-(6-oxopiperidin-3-yl)-2H-triazole-4-carboxamide.
| Compound Name | N-(6-oxopiperidin-3-yl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 78918284 |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | N-(6-oxopiperidin-3-yl)-2H-triazole-4-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2cn[nH]n2)CN1 |
| InChI | InChI=1S/C8H11N5O2/c14-7-2-1-5(3-9-7)11-8(15)6-4-10-13-12-6/h4-5H,1-3H2,(H,9,14)(H,11,15)(H,10,12,13) |
| InChIKey | UABQBFGFWRNWBX-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |