C11H17N3O2 — CID 104957396
N-[(1S,2S)-2-hydroxycyclohexyl]-5-methyl-1H-pyrazole-4-carboxamide (PubChem CID 104957396) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-5-methyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-5-methyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 104957396 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-5-methyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1[nH]ncc1C(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C11H17N3O2/c1-7-8(6-12-14-7)11(16)13-9-4-2-3-5-10(9)15/h6,9-10,15H,2-5H2,1H3,(H,12,14)(H,13,16)/t9-,10-/m0/s1 |
| InChIKey | CJNZANUJRXZFKM-UWVGGRQHSA-N |
| XLogP | 0.75 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |