C12H19N3O2 — CID 104927400
N-[(1R,2R)-2-hydroxycyclohexyl]-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 104927400) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 104927400 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)cc1C(=O)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C12H19N3O2/c1-8-9(7-15(2)14-8)12(17)13-10-5-3-4-6-11(10)16/h7,10-11,16H,3-6H2,1-2H3,(H,13,17)/t10-,11-/m1/s1 |
| InChIKey | PLUJRVOEHVTWBS-GHMZBOCLSA-N |
| XLogP | 0.76 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |