C18H23N3O3 — CID 91776232
1,3-dimethyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-4-carboxamide (PubChem CID 91776232) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1,3-dimethyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-4-carboxamide.
| Compound Name | 1,3-dimethyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 91776232 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1,3-dimethyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)cc1C(=O)N[C@@H]1COCC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C18H23N3O3/c1-13-15(10-21(2)20-13)18(22)19-16-12-23-9-8-17(16)24-11-14-6-4-3-5-7-14/h3-7,10,16-17H,8-9,11-12H2,1-2H3,(H,19,22)/t16-,17+/m1/s1 |
| InChIKey | KSEQWKSFNMJWTP-SJORKVTESA-N |
| XLogP | 1.83 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |