C17H21N3O3 — CID 91777487
2-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-carboxamide (PubChem CID 91777487) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-carboxamide.
| Compound Name | 2-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 91777487 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)N[C@@H]1COCC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C17H21N3O3/c1-20-15(7-9-18-20)17(21)19-14-12-22-10-8-16(14)23-11-13-5-3-2-4-6-13/h2-7,9,14,16H,8,10-12H2,1H3,(H,19,21)/t14-,16+/m1/s1 |
| InChIKey | KYQPOCLJVDNZAS-ZBFHGGJFSA-N |
| XLogP | 1.52 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |