C19H25N3O3 — CID 91769972
2-ethyl-5-methyl-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]pyrazole-3-carboxamide (PubChem CID 91769972) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-ethyl-5-methyl-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]pyrazole-3-carboxamide.
| Compound Name | 2-ethyl-5-methyl-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 91769972 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-ethyl-5-methyl-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]pyrazole-3-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)N[C@@H]1CCOC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H25N3O3/c1-3-22-17(11-14(2)21-22)19(23)20-16-9-10-24-13-18(16)25-12-15-7-5-4-6-8-15/h4-8,11,16,18H,3,9-10,12-13H2,1-2H3,(H,20,23)/t16-,18-/m1/s1 |
| InChIKey | HGHUKJIWTIFQFS-SJLPKXTDSA-N |
| XLogP | 2.32 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |