C18H20N2O4 — CID 91768844
3-hydroxy-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]pyridine-2-carboxamide (PubChem CID 91768844) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-hydroxy-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]pyridine-2-carboxamide.
| Compound Name | 3-hydroxy-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 91768844 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3-hydroxy-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]pyridine-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCOC[C@H]1OCc1ccccc1)c1ncccc1O |
| InChI | InChI=1S/C18H20N2O4/c21-15-7-4-9-19-17(15)18(22)20-14-8-10-23-12-16(14)24-11-13-5-2-1-3-6-13/h1-7,9,14,16,21H,8,10-12H2,(H,20,22)/t14-,16-/m1/s1 |
| InChIKey | PLOTUZCLHSICNE-GDBMZVCRSA-N |
| XLogP | 1.89 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |