C20H24N2O5 — CID 91765136
2,6-dimethoxy-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]pyridine-3-carboxamide (PubChem CID 91765136) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]pyridine-3-carboxamide.
| Compound Name | 2,6-dimethoxy-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91765136 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2,6-dimethoxy-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]pyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2CCOC[C@H]2OCc2ccccc2)c(OC)n1 |
| InChI | InChI=1S/C20H24N2O5/c1-24-18-9-8-15(20(22-18)25-2)19(23)21-16-10-11-26-13-17(16)27-12-14-6-4-3-5-7-14/h3-9,16-17H,10-13H2,1-2H3,(H,21,23)/t16-,17-/m1/s1 |
| InChIKey | UCYKDRAEMFJRJB-IAGOWNOFSA-N |
| XLogP | 2.20 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |