C17H20N2O4 — CID 91775648
3-methyl-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-1,2-oxazole-5-carboxamide (PubChem CID 91775648) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-methyl-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | 3-methyl-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 91775648 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 3-methyl-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@@H]2CCOC[C@H]2OCc2ccccc2)on1 |
| InChI | InChI=1S/C17H20N2O4/c1-12-9-15(23-19-12)17(20)18-14-7-8-21-11-16(14)22-10-13-5-3-2-4-6-13/h2-6,9,14,16H,7-8,10-11H2,1H3,(H,18,20)/t14-,16-/m1/s1 |
| InChIKey | LFEWODSRZUWCSE-GDBMZVCRSA-N |
| XLogP | 2.09 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |