C18H21ClN2O4 — CID 91790407
3-(3-chloro-1,2-oxazol-5-yl)-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]propanamide (PubChem CID 91790407) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is 3-(3-chloro-1,2-oxazol-5-yl)-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]propanamide.
| Compound Name | 3-(3-chloro-1,2-oxazol-5-yl)-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]propanamide |
|---|---|
| PubChem CID | 91790407 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-(3-chloro-1,2-oxazol-5-yl)-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]propanamide |
| SMILES | O=C(CCc1cc(Cl)no1)N[C@@H]1CCOC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C18H21ClN2O4/c19-17-10-14(25-21-17)6-7-18(22)20-15-8-9-23-12-16(15)24-11-13-4-2-1-3-5-13/h1-5,10,15-16H,6-9,11-12H2,(H,20,22)/t15-,16-/m1/s1 |
| InChIKey | GPTZQAWVRJNCKU-HZPDHXFCSA-N |
| XLogP | 2.75 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |