C19H28N2O4 — CID 91795731
3-(oxazinan-2-yl)-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]propanamide (PubChem CID 91795731) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 3-(oxazinan-2-yl)-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]propanamide.
| Compound Name | 3-(oxazinan-2-yl)-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]propanamide |
|---|---|
| PubChem CID | 91795731 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 3-(oxazinan-2-yl)-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]propanamide |
| SMILES | O=C(CCN1CCCCO1)N[C@@H]1CCOC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H28N2O4/c22-19(8-11-21-10-4-5-12-25-21)20-17-9-13-23-15-18(17)24-14-16-6-2-1-3-7-16/h1-3,6-7,17-18H,4-5,8-15H2,(H,20,22)/t17-,18-/m1/s1 |
| InChIKey | YYNPAJSWOPYGTB-QZTJIDSGSA-N |
| XLogP | 1.89 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |