C20H30N2O3 — CID 91766954
N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-3-piperidin-1-ylpropanamide (PubChem CID 91766954) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-3-piperidin-1-ylpropanamide.
| Compound Name | N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 91766954 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-3-piperidin-1-ylpropanamide |
| SMILES | O=C(CCN1CCCCC1)N[C@@H]1CCOC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H30N2O3/c23-20(9-13-22-11-5-2-6-12-22)21-18-10-14-24-16-19(18)25-15-17-7-3-1-4-8-17/h1,3-4,7-8,18-19H,2,5-6,9-16H2,(H,21,23)/t18-,19-/m1/s1 |
| InChIKey | SVUSOQDCPKUBSQ-RTBURBONSA-N |
| XLogP | 2.35 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |