C17H24N2O3 — CID 91830789
N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrrolidine-1-carboxamide (PubChem CID 91830789) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrrolidine-1-carboxamide.
| Compound Name | N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 91830789 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrrolidine-1-carboxamide |
| SMILES | O=C(N[C@@H]1COCC[C@@H]1OCc1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C17H24N2O3/c20-17(19-9-4-5-10-19)18-15-13-21-11-8-16(15)22-12-14-6-2-1-3-7-14/h1-3,6-7,15-16H,4-5,8-13H2,(H,18,20)/t15-,16+/m1/s1 |
| InChIKey | XTYXTNCIIWNFKW-CVEARBPZSA-N |
| XLogP | 2.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |