C16H18N2O4 — CID 91797210
N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1,2-oxazole-3-carboxamide (PubChem CID 91797210) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 91797210 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(N[C@@H]1COCC[C@@H]1OCc1ccccc1)c1ccon1 |
| InChI | InChI=1S/C16H18N2O4/c19-16(13-6-9-22-18-13)17-14-11-20-8-7-15(14)21-10-12-4-2-1-3-5-12/h1-6,9,14-15H,7-8,10-11H2,(H,17,19)/t14-,15+/m1/s1 |
| InChIKey | YQSUPVQWEDEFQO-CABCVRRESA-N |
| XLogP | 1.78 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |