C17H21N3O3 — CID 91776631
5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-imidazole-2-carboxamide (PubChem CID 91776631) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-imidazole-2-carboxamide.
| Compound Name | 5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 91776631 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-imidazole-2-carboxamide |
| SMILES | Cc1cnc(C(=O)N[C@@H]2COCC[C@@H]2OCc2ccccc2)[nH]1 |
| InChI | InChI=1S/C17H21N3O3/c1-12-9-18-16(19-12)17(21)20-14-11-22-8-7-15(14)23-10-13-5-3-2-4-6-13/h2-6,9,14-15H,7-8,10-11H2,1H3,(H,18,19)(H,20,21)/t14-,15+/m1/s1 |
| InChIKey | OQTNEBVSZLWNOI-CABCVRRESA-N |
| XLogP | 1.82 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |