C19H22N2O5 — CID 156609001
5-methoxy-4-oxo-N-(4-phenylmethoxyoxan-3-yl)-1H-pyridine-2-carboxamide (PubChem CID 156609001) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 5-methoxy-4-oxo-N-(4-phenylmethoxyoxan-3-yl)-1H-pyridine-2-carboxamide.
| Compound Name | 5-methoxy-4-oxo-N-(4-phenylmethoxyoxan-3-yl)-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 156609001 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 5-methoxy-4-oxo-N-(4-phenylmethoxyoxan-3-yl)-1H-pyridine-2-carboxamide |
| SMILES | COc1c[nH]c(C(=O)NC2COCCC2OCc2ccccc2)cc1=O |
| InChI | InChI=1S/C19H22N2O5/c1-24-18-10-20-14(9-16(18)22)19(23)21-15-12-25-8-7-17(15)26-11-13-5-3-2-4-6-13/h2-6,9-10,15,17H,7-8,11-12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | HMOVKXPNIMXXJR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |