C18H19ClN2O4 — CID 91775793
5-chloro-6-oxo-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-1H-pyridine-3-carboxamide (PubChem CID 91775793) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is 5-chloro-6-oxo-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-1H-pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-oxo-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91775793 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 5-chloro-6-oxo-N-[(3S,4R)-3-phenylmethoxyoxan-4-yl]-1H-pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCOC[C@H]1OCc1ccccc1)c1c[nH]c(=O)c(Cl)c1 |
| InChI | InChI=1S/C18H19ClN2O4/c19-14-8-13(9-20-18(14)23)17(22)21-15-6-7-24-11-16(15)25-10-12-4-2-1-3-5-12/h1-5,8-9,15-16H,6-7,10-11H2,(H,20,23)(H,21,22)/t15-,16-/m1/s1 |
| InChIKey | ADYAMEYGSXSELS-HZPDHXFCSA-N |
| XLogP | 2.13 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |