C20H22N2O4 — CID 91781998
4-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]benzene-1,4-dicarboxamide (PubChem CID 91781998) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 4-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 91781998 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)N[C@@H]2COCC[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N2O4/c21-19(23)15-6-8-16(9-7-15)20(24)22-17-13-25-11-10-18(17)26-12-14-4-2-1-3-5-14/h1-9,17-18H,10-13H2,(H2,21,23)(H,22,24)/t17-,18+/m1/s1 |
| InChIKey | KLPOVXZSJULXLV-MSOLQXFVSA-N |
| XLogP | 1.89 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |