C14H17FN2O4 — CID 91767703
N-[(3R,4S)-4-(2-amino-2-oxoethoxy)oxan-3-yl]-4-fluorobenzamide (PubChem CID 91767703) has the molecular formula C14H17FN2O4 and a molecular weight of 296.30 g/mol. Its IUPAC name is N-[(3R,4S)-4-(2-amino-2-oxoethoxy)oxan-3-yl]-4-fluorobenzamide.
| Compound Name | N-[(3R,4S)-4-(2-amino-2-oxoethoxy)oxan-3-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 91767703 |
| Molecular Formula | C14H17FN2O4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-[(3R,4S)-4-(2-amino-2-oxoethoxy)oxan-3-yl]-4-fluorobenzamide |
| SMILES | NC(=O)CO[C@H]1CCOC[C@H]1NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H17FN2O4/c15-10-3-1-9(2-4-10)14(19)17-11-7-20-6-5-12(11)21-8-13(16)18/h1-4,11-12H,5-8H2,(H2,16,18)(H,17,19)/t11-,12+/m1/s1 |
| InChIKey | VICBCEJOAASVNI-NEPJUHHUSA-N |
| XLogP | 0.21 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |