C14H14ClF2NO5 — CID 91779623
2-[(3R,4S)-3-[(2-chloro-4,5-difluorobenzoyl)amino]oxan-4-yl]oxyacetic acid (PubChem CID 91779623) has the molecular formula C14H14ClF2NO5 and a molecular weight of 349.72 g/mol. Its IUPAC name is 2-[(3R,4S)-3-[(2-chloro-4,5-difluorobenzoyl)amino]oxan-4-yl]oxyacetic acid.
| Compound Name | 2-[(3R,4S)-3-[(2-chloro-4,5-difluorobenzoyl)amino]oxan-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 91779623 |
| Molecular Formula | C14H14ClF2NO5 |
| Molecular Weight | 349.72 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 2-[(3R,4S)-3-[(2-chloro-4,5-difluorobenzoyl)amino]oxan-4-yl]oxyacetic acid |
| SMILES | O=C(O)CO[C@H]1CCOC[C@H]1NC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C14H14ClF2NO5/c15-8-4-10(17)9(16)3-7(8)14(21)18-11-5-22-2-1-12(11)23-6-13(19)20/h3-4,11-12H,1-2,5-6H2,(H,18,21)(H,19,20)/t11-,12+/m1/s1 |
| InChIKey | JRVXOCDMSQLVEP-NEPJUHHUSA-N |
| XLogP | 1.61 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.72 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|